C38H24N2O2S2 — CID 138622669
2,9-bis(1-benzothiophen-4-yl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 138622669) has the molecular formula C38H24N2O2S2 and a molecular weight of 604.76 g/mol. Its IUPAC name is 2,9-bis(1-benzothiophen-4-yl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,9-bis(1-benzothiophen-4-yl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 138622669 |
| Molecular Formula | C38H24N2O2S2 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 2,9-bis(1-benzothiophen-4-yl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cn1c2ccc(-c3cccc4sccc34)cc2c(=O)c2cc3c(cc21)c(=O)c1cc(-c2cccc4sccc24)ccc1n3C |
| InChI | InChI=1S/C38H24N2O2S2/c1-39-31-11-9-21(23-5-3-7-35-25(23)13-15-43-35)17-27(31)37(41)29-20-34-30(19-33(29)39)38(42)28-18-22(10-12-32(28)40(34)2)24-6-4-8-36-26(24)14-16-44-36/h3-20H,1-2H3 |
| InChIKey | USLJQTNASRPDNA-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|