C17H12N2OS — CID 139804736
10-methyl-3-(1,3-thiazol-2-yl)acridin-9-one (PubChem CID 139804736) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 10-methyl-3-(1,3-thiazol-2-yl)acridin-9-one.
| Compound Name | 10-methyl-3-(1,3-thiazol-2-yl)acridin-9-one |
|---|---|
| PubChem CID | 139804736 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 10-methyl-3-(1,3-thiazol-2-yl)acridin-9-one |
| SMILES | Cn1c2ccccc2c(=O)c2ccc(-c3nccs3)cc21 |
| InChI | InChI=1S/C17H12N2OS/c1-19-14-5-3-2-4-12(14)16(20)13-7-6-11(10-15(13)19)17-18-8-9-21-17/h2-10H,1H3 |
| InChIKey | IAFYCPHHFHVWNG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|