C18H13ClN2O — CID 72546975
2-(2-chlorophenyl)-5-methyl-3H-pyrrolo[2,3-c]quinolin-4-one (PubChem CID 72546975) has the molecular formula C18H13ClN2O and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-methyl-3H-pyrrolo[2,3-c]quinolin-4-one.
| Compound Name | 2-(2-chlorophenyl)-5-methyl-3H-pyrrolo[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 72546975 |
| Molecular Formula | C18H13ClN2O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(2-chlorophenyl)-5-methyl-3H-pyrrolo[2,3-c]quinolin-4-one |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccccc3Cl)cc2c2ccccc21 |
| InChI | InChI=1S/C18H13ClN2O/c1-21-16-9-5-3-6-11(16)13-10-15(20-17(13)18(21)22)12-7-2-4-8-14(12)19/h2-10,20H,1H3 |
| InChIKey | SMPBREXCMRRIAW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |