C10H6ClNO3 — CID 586793
4-(2-chlorophenyl)-3H-1,3-oxazine-2,6-dione (PubChem CID 586793) has the molecular formula C10H6ClNO3 and a molecular weight of 223.62 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3H-1,3-oxazine-2,6-dione.
| Compound Name | 4-(2-chlorophenyl)-3H-1,3-oxazine-2,6-dione |
|---|---|
| PubChem CID | 586793 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 4-(2-chlorophenyl)-3H-1,3-oxazine-2,6-dione |
| SMILES | O=c1cc(-c2ccccc2Cl)[nH]c(=O)o1 |
| InChI | InChI=1S/C10H6ClNO3/c11-7-4-2-1-3-6(7)8-5-9(13)15-10(14)12-8/h1-5H,(H,12,14) |
| InChIKey | SKJOPTOBUFXKMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |