C46H28Cl4N2O2 — CID 139320969
1,3,8,10-tetrakis(4-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 139320969) has the molecular formula C46H28Cl4N2O2 and a molecular weight of 782.55 g/mol. Its IUPAC name is 1,3,8,10-tetrakis(4-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 1,3,8,10-tetrakis(4-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139320969 |
| Molecular Formula | C46H28Cl4N2O2 |
| Molecular Weight | 782.55 g/mol |
| Exact Mass | 780.09 |
| IUPAC Name | 1,3,8,10-tetrakis(4-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cn1c2cc3c(=O)c4c(-c5ccc(Cl)cc5)cc(-c5ccc(Cl)cc5)cc4n(C)c3cc2c(=O)c2c(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C46H28Cl4N2O2/c1-51-39-23-38-40(52(2)42-22-30(26-5-13-32(48)14-6-26)20-36(44(42)46(38)54)28-9-17-34(50)18-10-28)24-37(39)45(53)43-35(27-7-15-33(49)16-8-27)19-29(21-41(43)51)25-3-11-31(47)12-4-25/h3-24H,1-2H3 |
| InChIKey | KLFCUTCUXVGBRY-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.55 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|