C23H19ClN2O2 — CID 118539667
8-chloro-3-cyclobutyl-5-methyl-2-phenylbenzo[b][1,6]naphthyridine-1,10-dione (PubChem CID 118539667) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 8-chloro-3-cyclobutyl-5-methyl-2-phenylbenzo[b][1,6]naphthyridine-1,10-dione.
| Compound Name | 8-chloro-3-cyclobutyl-5-methyl-2-phenylbenzo[b][1,6]naphthyridine-1,10-dione |
|---|---|
| PubChem CID | 118539667 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 8-chloro-3-cyclobutyl-5-methyl-2-phenylbenzo[b][1,6]naphthyridine-1,10-dione |
| SMILES | Cn1c2ccc(Cl)cc2c(=O)c2c(=O)n(-c3ccccc3)c(C3CCC3)cc21 |
| InChI | InChI=1S/C23H19ClN2O2/c1-25-18-11-10-15(24)12-17(18)22(27)21-20(25)13-19(14-6-5-7-14)26(23(21)28)16-8-3-2-4-9-16/h2-4,8-14H,5-7H2,1H3 |
| InChIKey | JREURABHKMOCMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|