C19H16ClNO — CID 50917306
6-chloro-1,2-dimethyl-3-[(E)-2-phenylethenyl]quinolin-4-one (PubChem CID 50917306) has the molecular formula C19H16ClNO and a molecular weight of 309.80 g/mol. Its IUPAC name is 6-chloro-1,2-dimethyl-3-[(E)-2-phenylethenyl]quinolin-4-one.
| Compound Name | 6-chloro-1,2-dimethyl-3-[(E)-2-phenylethenyl]quinolin-4-one |
|---|---|
| PubChem CID | 50917306 |
| Molecular Formula | C19H16ClNO |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 6-chloro-1,2-dimethyl-3-[(E)-2-phenylethenyl]quinolin-4-one |
| SMILES | Cc1c(/C=C/c2ccccc2)c(=O)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C19H16ClNO/c1-13-16(10-8-14-6-4-3-5-7-14)19(22)17-12-15(20)9-11-18(17)21(13)2/h3-12H,1-2H3/b10-8+ |
| InChIKey | PJLXOQJMTPWOMC-CSKARUKUSA-N |
| XLogP | 4.67 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |