C112H100 — CID 162774562
2,5,8,11-tetrakis[2,6-bis(2,6-dimethylphenyl)-4-methylphenyl]perylene (PubChem CID 162774562) has the molecular formula C112H100 and a molecular weight of 1446.03 g/mol. Its IUPAC name is 2,5,8,11-tetrakis[2,6-bis(2,6-dimethylphenyl)-4-methylphenyl]perylene.
| Compound Name | 2,5,8,11-tetrakis[2,6-bis(2,6-dimethylphenyl)-4-methylphenyl]perylene |
|---|---|
| PubChem CID | 162774562 |
| Molecular Formula | C112H100 |
| Molecular Weight | 1446.03 g/mol |
| Exact Mass | 1444.78 |
| IUPAC Name | 2,5,8,11-tetrakis[2,6-bis(2,6-dimethylphenyl)-4-methylphenyl]perylene |
| SMILES | Cc1cc(-c2c(C)cccc2C)c(-c2cc3cc(-c4c(-c5c(C)cccc5C)cc(C)cc4-c4c(C)cccc4C)cc4c5cc(-c6c(-c7c(C)cccc7C)cc(C)cc6-c6c(C)cccc6C)cc6cc(-c7c(-c8c(C)cccc8C)cc(C)cc7-c7c(C)cccc7C)cc(c(c2)c34)c65)c(-c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C112H100/c1-61-45-91(99-65(5)29-21-30-66(99)6)109(92(46-61)100-67(7)31-22-32-68(100)8)83-53-81-54-84(110-93(101-69(9)33-23-34-70(101)10)47-62(2)48-94(110)102-71(11)35-24-36-72(102)12)59-89-90-60-86(112-97(105-77(17)41-27-42-78(105)18)51-64(4)52-98(112)106-79(19)43-28-44-80(106)20)56-82-55-85(58-88(108(82)90)87(57-83)107(81)89)111-95(103-73(13)37-25-38-74(103)14)49-63(3)50-96(111)104-75(15)39-26-40-76(104)16/h21-60H,1-20H3 |
| InChIKey | NUHIFTWBGZXVSL-UHFFFAOYSA-N |
| XLogP | 31.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 112 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1446.03 |
| LogP ≤ 5 | 31.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|