C21H16IrN- — CID 140719040
5-(2,6-dimethylphenyl)-10H-benzo[h]quinolin-10-ide;iridium (PubChem CID 140719040) has the molecular formula C21H16IrN- and a molecular weight of 474.58 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-10H-benzo[h]quinolin-10-ide;iridium.
| Compound Name | 5-(2,6-dimethylphenyl)-10H-benzo[h]quinolin-10-ide;iridium |
|---|---|
| PubChem CID | 140719040 |
| Molecular Formula | C21H16IrN- |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-10H-benzo[h]quinolin-10-ide;iridium |
| SMILES | Cc1cccc(C)c1-c1cc2ccc[c-]c2c2ncccc12.[Ir] |
| InChI | InChI=1S/C21H16N.Ir/c1-14-7-5-8-15(2)20(14)19-13-16-9-3-4-10-17(16)21-18(19)11-6-12-22-21;/h3-9,11-13H,1-2H3;/q-1; |
| InChIKey | VSKMAQIAJJWNPK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|