C24H18IrNS- — CID 59358927
7-(2,6-dimethylphenyl)-2-methyl-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium (PubChem CID 59358927) has the molecular formula C24H18IrNS- and a molecular weight of 544.70 g/mol. Its IUPAC name is 7-(2,6-dimethylphenyl)-2-methyl-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium.
| Compound Name | 7-(2,6-dimethylphenyl)-2-methyl-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium |
|---|---|
| PubChem CID | 59358927 |
| Molecular Formula | C24H18IrNS- |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 7-(2,6-dimethylphenyl)-2-methyl-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium |
| SMILES | Cc1nc2c3[c-]ccc(-c4c(C)cccc4C)c3c3ccccc3c2s1.[Ir] |
| InChI | InChI=1S/C24H18NS.Ir/c1-14-8-6-9-15(2)21(14)19-12-7-13-20-22(19)17-10-4-5-11-18(17)24-23(20)25-16(3)26-24;/h4-12H,1-3H3;/q-1; |
| InChIKey | PAWIBBTUKMEPST-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|