4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid

C13H13NO2S — CID 131867670

IUPAC4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(-c2c(C)cccc2C)c(C(=O)O)s1
InChIInChI=1S/C13H13NO2S/c1-7-5-4-6-8(2)10(7)11-12(13(15)16)17-9(3)14-11/h4-6H,1-3H3,(H,15,16)
InChIKeyNPGUDIBWFNVDFE-UHFFFAOYSA-N
MW247.32 g/mol
LogP3.43
Rot. Bonds2

About 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid

4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 131867670) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID131867670
Molecular FormulaC13H13NO2S
Molecular Weight247.32 g/mol
Exact Mass247.07
IUPAC Name4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(-c2c(C)cccc2C)c(C(=O)O)s1
InChIInChI=1S/C13H13NO2S/c1-7-5-4-6-8(2)10(7)11-12(13(15)16)17-9(3)14-11/h4-6H,1-3H3,(H,15,16)
InChIKeyNPGUDIBWFNVDFE-UHFFFAOYSA-N
XLogP3.43
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.32
LogP ≤ 53.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid (CID 131867670) is 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(-c2c(C)cccc2C)c(C(=O)O)s1.
What is the InChIKey of 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is NPGUDIBWFNVDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2S/c1-7-5-4-6-8(2)10(7)11-12(13(15)16)17-9(3)14-11/h4-6H,1-3H3,(H,15,16).
What are the key properties of 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid?
4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 247.32 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethylphenyl)-2-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 131867670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).