C34H28O5 — CID 121306782
3-[2-[7-[2-(2-carboxyethyl)phenyl]-10-ethylidene-9-oxoanthracen-2-yl]phenyl]propanoic acid (PubChem CID 121306782) has the molecular formula C34H28O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is 3-[2-[7-[2-(2-carboxyethyl)phenyl]-10-ethylidene-9-oxoanthracen-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[2-[7-[2-(2-carboxyethyl)phenyl]-10-ethylidene-9-oxoanthracen-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121306782 |
| Molecular Formula | C34H28O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-[2-[7-[2-(2-carboxyethyl)phenyl]-10-ethylidene-9-oxoanthracen-2-yl]phenyl]propanoic acid |
| SMILES | CC=C1c2ccc(-c3ccccc3CCC(=O)O)cc2C(=O)c2cc(-c3ccccc3CCC(=O)O)ccc21 |
| InChI | InChI=1S/C34H28O5/c1-2-25-28-15-11-23(26-9-5-3-7-21(26)13-17-32(35)36)19-30(28)34(39)31-20-24(12-16-29(25)31)27-10-6-4-8-22(27)14-18-33(37)38/h2-12,15-16,19-20H,13-14,17-18H2,1H3,(H,35,36)(H,37,38) |
| InChIKey | BOAANXPFVRCAKD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |