C24H26O4 — CID 162130396
3-[5-hydroxy-2-[3-(hydroxymethyl)-4-(3-methylphenyl)phenyl]phenyl]propanoic acid;methane (PubChem CID 162130396) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-[5-hydroxy-2-[3-(hydroxymethyl)-4-(3-methylphenyl)phenyl]phenyl]propanoic acid;methane.
| Compound Name | 3-[5-hydroxy-2-[3-(hydroxymethyl)-4-(3-methylphenyl)phenyl]phenyl]propanoic acid;methane |
|---|---|
| PubChem CID | 162130396 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-[5-hydroxy-2-[3-(hydroxymethyl)-4-(3-methylphenyl)phenyl]phenyl]propanoic acid;methane |
| SMILES | C.Cc1cccc(-c2ccc(-c3ccc(O)cc3CCC(=O)O)cc2CO)c1 |
| InChI | InChI=1S/C23H22O4.CH4/c1-15-3-2-4-16(11-15)22-8-5-17(12-19(22)14-24)21-9-7-20(25)13-18(21)6-10-23(26)27;/h2-5,7-9,11-13,24-25H,6,10,14H2,1H3,(H,26,27);1H4 |
| InChIKey | ZIOWIDZQVYWPAJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |