C25H28O3 — CID 162205972
methane;3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoic acid (PubChem CID 162205972) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is methane;3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoic acid.
| Compound Name | methane;3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 162205972 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methane;3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoic acid |
| SMILES | C.COc1ccc(-c2ccc(-c3cccc(C)c3)c(C)c2)c(CCC(=O)O)c1 |
| InChI | InChI=1S/C24H24O3.CH4/c1-16-5-4-6-18(13-16)22-10-7-19(14-17(22)2)23-11-9-21(27-3)15-20(23)8-12-24(25)26;/h4-7,9-11,13-15H,8,12H2,1-3H3,(H,25,26);1H4 |
| InChIKey | ZSEPXMNVOGXULN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |