C26H28O3 — CID 52918587
ethyl 3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoate (PubChem CID 52918587) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl 3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoate.
| Compound Name | ethyl 3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 52918587 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl 3-[5-methoxy-2-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(OC)ccc1-c1ccc(-c2cccc(C)c2)c(C)c1 |
| InChI | InChI=1S/C26H28O3/c1-5-29-26(27)14-10-22-17-23(28-4)11-13-25(22)21-9-12-24(19(3)16-21)20-8-6-7-18(2)15-20/h6-9,11-13,15-17H,5,10,14H2,1-4H3 |
| InChIKey | HOKWAXWLYAVMBR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |