C26H27ClO3 — CID 118198123
ethyl 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methoxyphenyl]propanoate (PubChem CID 118198123) has the molecular formula C26H27ClO3 and a molecular weight of 422.95 g/mol. Its IUPAC name is ethyl 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methoxyphenyl]propanoate.
| Compound Name | ethyl 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 118198123 |
| Molecular Formula | C26H27ClO3 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methoxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(OC)ccc1-c1ccc(-c2ccc(C)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C26H27ClO3/c1-5-30-26(28)13-9-20-15-22(29-4)10-12-24(20)19-8-11-23(18(3)14-19)21-7-6-17(2)25(27)16-21/h6-8,10-12,14-16H,5,9,13H2,1-4H3 |
| InChIKey | IONDLLHUDXXRMN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |