C24H23ClO2 — CID 118198119
3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methylphenyl]propanoic acid (PubChem CID 118198119) has the molecular formula C24H23ClO2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methylphenyl]propanoic acid.
| Compound Name | 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 118198119 |
| Molecular Formula | C24H23ClO2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[2-[4-(3-chloro-4-methylphenyl)-3-methylphenyl]-5-methylphenyl]propanoic acid |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)c(Cl)c3)c(C)c2)c(CCC(=O)O)c1 |
| InChI | InChI=1S/C24H23ClO2/c1-15-4-9-22(18(12-15)8-11-24(26)27)19-7-10-21(17(3)13-19)20-6-5-16(2)23(25)14-20/h4-7,9-10,12-14H,8,11H2,1-3H3,(H,26,27) |
| InChIKey | FPKZXLNCMWEEEA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |