C22H26O6 — CID 175709429
ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-2-methyl-4-(3-methylphenyl)phenoxy]acetate (PubChem CID 175709429) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-2-methyl-4-(3-methylphenyl)phenoxy]acetate.
| Compound Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-2-methyl-4-(3-methylphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 175709429 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-2-methyl-4-(3-methylphenyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2cccc(C)c2)c(OCC(=O)OCC)c1C |
| InChI | InChI=1S/C22H26O6/c1-5-25-20(23)13-27-19-11-10-18(17-9-7-8-15(3)12-17)22(16(19)4)28-14-21(24)26-6-2/h7-12H,5-6,13-14H2,1-4H3 |
| InChIKey | MSTRQBBGSOSFPE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |