C40H40O12S4 — CID 15471713
ethyl 2-[[26,27,28-tris(2-ethoxy-2-oxoethoxy)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-25-yl]oxy]acetate (PubChem CID 15471713) has the molecular formula C40H40O12S4 and a molecular weight of 841.02 g/mol. Its IUPAC name is ethyl 2-[[26,27,28-tris(2-ethoxy-2-oxoethoxy)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-25-yl]oxy]acetate.
| Compound Name | ethyl 2-[[26,27,28-tris(2-ethoxy-2-oxoethoxy)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-25-yl]oxy]acetate |
|---|---|
| PubChem CID | 15471713 |
| Molecular Formula | C40H40O12S4 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.14 |
| IUPAC Name | ethyl 2-[[26,27,28-tris(2-ethoxy-2-oxoethoxy)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-25-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1c2cccc1Sc1cccc(c1OCC(=O)OCC)Sc1cccc(c1OCC(=O)OCC)Sc1cccc(c1OCC(=O)OCC)S2 |
| InChI | InChI=1S/C40H40O12S4/c1-5-45-33(41)21-49-37-25-13-9-14-26(37)54-28-16-11-18-30(39(28)51-23-35(43)47-7-3)56-32-20-12-19-31(40(32)52-24-36(44)48-8-4)55-29-17-10-15-27(53-25)38(29)50-22-34(42)46-6-2/h9-20H,5-8,21-24H2,1-4H3 |
| InChIKey | GQEGHNYEFCZFTA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|