C19H22N2O2S — CID 142191015
(Z)-3-amino-N-[[5-methoxy-2-(3-methylphenyl)phenyl]methyl]-2-sulfanylbut-2-enamide (PubChem CID 142191015) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (Z)-3-amino-N-[[5-methoxy-2-(3-methylphenyl)phenyl]methyl]-2-sulfanylbut-2-enamide.
| Compound Name | (Z)-3-amino-N-[[5-methoxy-2-(3-methylphenyl)phenyl]methyl]-2-sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 142191015 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (Z)-3-amino-N-[[5-methoxy-2-(3-methylphenyl)phenyl]methyl]-2-sulfanylbut-2-enamide |
| SMILES | COc1ccc(-c2cccc(C)c2)c(CNC(=O)/C(S)=C(\C)N)c1 |
| InChI | InChI=1S/C19H22N2O2S/c1-12-5-4-6-14(9-12)17-8-7-16(23-3)10-15(17)11-21-19(22)18(24)13(2)20/h4-10,24H,11,20H2,1-3H3,(H,21,22)/b18-13- |
| InChIKey | BHFQWEOMGFAVSB-AQTBWJFISA-N |
| XLogP | 3.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|