C17H13NO3 — CID 143781569
4-(6-phenyl-3-pyridinyl)benzene-1,2,3-triol (PubChem CID 143781569) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-(6-phenyl-3-pyridinyl)benzene-1,2,3-triol.
| Compound Name | 4-(6-phenyl-3-pyridinyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 143781569 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-(6-phenyl-3-pyridinyl)benzene-1,2,3-triol |
| SMILES | Oc1ccc(-c2ccc(-c3ccccc3)nc2)c(O)c1O |
| InChI | InChI=1S/C17H13NO3/c19-15-9-7-13(16(20)17(15)21)12-6-8-14(18-10-12)11-4-2-1-3-5-11/h1-10,19-21H |
| InChIKey | RRRXHZYXTAMUSY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|