C26H32NS+ — CID 177095977
5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-propan-2-ylsulfanylpyridin-1-ium (PubChem CID 177095977) has the molecular formula C26H32NS+ and a molecular weight of 400.68 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-propan-2-ylsulfanylpyridin-1-ium.
| Compound Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-propan-2-ylsulfanylpyridin-1-ium |
|---|---|
| PubChem CID | 177095977 |
| Molecular Formula | C26H32NS+ |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-propan-2-ylsulfanylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(SC(C)C)c(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c[n+]2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C26H32NS/c1-17(2)24-16-27(7)25(15-26(24)28-18(3)4)23-14-22(19(5)13-20(23)6)21-11-9-8-10-12-21/h8-18H,1-7H3/q+1/i1D3,2D3,5D3,17D |
| InChIKey | UCHYZPUKTYSIRT-XIDPLSMZSA-N |
| XLogP | 7.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|