C28H36N+ — CID 153461114
2-(2,4-dimethyl-5-phenylphenyl)-1-methyl-4,5-bis(2-methylpropyl)pyridin-1-ium (PubChem CID 153461114) has the molecular formula C28H36N+ and a molecular weight of 386.60 g/mol. Its IUPAC name is 2-(2,4-dimethyl-5-phenylphenyl)-1-methyl-4,5-bis(2-methylpropyl)pyridin-1-ium.
| Compound Name | 2-(2,4-dimethyl-5-phenylphenyl)-1-methyl-4,5-bis(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 153461114 |
| Molecular Formula | C28H36N+ |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-(2,4-dimethyl-5-phenylphenyl)-1-methyl-4,5-bis(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1cc(C)c(-c2cc(CC(C)C)c(CC(C)C)c[n+]2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C28H36N/c1-19(2)13-24-16-28(29(7)18-25(24)14-20(3)4)27-17-26(21(5)15-22(27)6)23-11-9-8-10-12-23/h8-12,15-20H,13-14H2,1-7H3/q+1 |
| InChIKey | HAFDLYUUYGARNZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|