C25H30N+ — CID 140920623
2-(2,4-dimethyl-5-phenylphenyl)-1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium (PubChem CID 140920623) has the molecular formula C25H30N+ and a molecular weight of 344.52 g/mol. Its IUPAC name is 2-(2,4-dimethyl-5-phenylphenyl)-1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 2-(2,4-dimethyl-5-phenylphenyl)-1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140920623 |
| Molecular Formula | C25H30N+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-(2,4-dimethyl-5-phenylphenyl)-1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2cc(-c3ccccc3)c(C)cc2C)cc1CC(C)C |
| InChI | InChI=1S/C25H30N/c1-17(2)12-22-14-25(26(6)16-20(22)5)24-15-23(18(3)13-19(24)4)21-10-8-7-9-11-21/h7-11,13-17H,12H2,1-6H3/q+1 |
| InChIKey | LIHDJYBJVJJOGA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|