C29H36N+ — CID 176865281
1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-(1,4,4-trimethylcyclohexyl)pyridin-1-ium (PubChem CID 176865281) has the molecular formula C29H36N+ and a molecular weight of 401.63 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-(1,4,4-trimethylcyclohexyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-(1,4,4-trimethylcyclohexyl)pyridin-1-ium |
|---|---|
| PubChem CID | 176865281 |
| Molecular Formula | C29H36N+ |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-(1,4,4-trimethylcyclohexyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C3(C)CCC(C)(C)CC3)cc[n+]2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C29H36N/c1-21-18-22(2)26(20-25(21)23-10-8-7-9-11-23)27-19-24(12-17-30(27)6)29(5)15-13-28(3,4)14-16-29/h7-12,17-20H,13-16H2,1-6H3/q+1/i1D3 |
| InChIKey | JZRIDVKQWFXUCP-FIBGUPNXSA-N |
| XLogP | 7.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|