C32H44N+ — CID 172534755
4-tert-butyl-2-[5-(3,5-ditert-butylphenyl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium (PubChem CID 172534755) has the molecular formula C32H44N+ and a molecular weight of 445.73 g/mol. Its IUPAC name is 4-tert-butyl-2-[5-(3,5-ditert-butylphenyl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-tert-butyl-2-[5-(3,5-ditert-butylphenyl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 172534755 |
| Molecular Formula | C32H44N+ |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.37 |
| IUPAC Name | 4-tert-butyl-2-[5-(3,5-ditert-butylphenyl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C(C)(C)C)cc[n+]2C)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H44N/c1-21-15-22(2)28(29-19-24(30(3,4)5)13-14-33(29)12)20-27(21)23-16-25(31(6,7)8)18-26(17-23)32(9,10)11/h13-20H,1-12H3/q+1/i1D3 |
| InChIKey | IPOSXFZXRFQHIR-FIBGUPNXSA-N |
| XLogP | 8.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|