C21H21N — CID 166564030
4-[4-(1,1-dideuterio-2-methylpropyl)phenyl]-2-phenylpyridine (PubChem CID 166564030) has the molecular formula C21H21N and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-[4-(1,1-dideuterio-2-methylpropyl)phenyl]-2-phenylpyridine.
| Compound Name | 4-[4-(1,1-dideuterio-2-methylpropyl)phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 166564030 |
| Molecular Formula | C21H21N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[4-(1,1-dideuterio-2-methylpropyl)phenyl]-2-phenylpyridine |
| SMILES | [2H]C([2H])(c1ccc(-c2ccnc(-c3ccccc3)c2)cc1)C(C)C |
| InChI | InChI=1S/C21H21N/c1-16(2)14-17-8-10-18(11-9-17)20-12-13-22-21(15-20)19-6-4-3-5-7-19/h3-13,15-16H,14H2,1-2H3/i14D2 |
| InChIKey | PSGYGODHLXIVEM-FNHLFAINSA-N |
| XLogP | 5.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |