C35H29N — CID 164792178
4-(1,1-dideuterio-2-methylpropyl)-2-(9,10-diphenylphenanthren-2-yl)pyridine (PubChem CID 164792178) has the molecular formula C35H29N and a molecular weight of 465.64 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2-methylpropyl)-2-(9,10-diphenylphenanthren-2-yl)pyridine.
| Compound Name | 4-(1,1-dideuterio-2-methylpropyl)-2-(9,10-diphenylphenanthren-2-yl)pyridine |
|---|---|
| PubChem CID | 164792178 |
| Molecular Formula | C35H29N |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 4-(1,1-dideuterio-2-methylpropyl)-2-(9,10-diphenylphenanthren-2-yl)pyridine |
| SMILES | [2H]C([2H])(c1ccnc(-c2ccc3c(c2)c(-c2ccccc2)c(-c2ccccc2)c2ccccc23)c1)C(C)C |
| InChI | InChI=1S/C35H29N/c1-24(2)21-25-19-20-36-33(22-25)28-17-18-30-29-15-9-10-16-31(29)34(26-11-5-3-6-12-26)35(32(30)23-28)27-13-7-4-8-14-27/h3-20,22-24H,21H2,1-2H3/i21D2 |
| InChIKey | QBHFHXGHWDFPCB-GQZVJHRESA-N |
| XLogP | 9.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|