C28H31NOSSi — CID 172520343
[8-(4-tert-butylnaphthalen-2-yl)-4,5-dimethyl-12-oxa-3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]-trimethylsilane (PubChem CID 172520343) has the molecular formula C28H31NOSSi and a molecular weight of 457.72 g/mol. Its IUPAC name is [8-(4-tert-butylnaphthalen-2-yl)-4,5-dimethyl-12-oxa-3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]-trimethylsilane.
| Compound Name | [8-(4-tert-butylnaphthalen-2-yl)-4,5-dimethyl-12-oxa-3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]-trimethylsilane |
|---|---|
| PubChem CID | 172520343 |
| Molecular Formula | C28H31NOSSi |
| Molecular Weight | 457.72 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [8-(4-tert-butylnaphthalen-2-yl)-4,5-dimethyl-12-oxa-3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]-trimethylsilane |
| SMILES | Cc1sc2c(nc(-c3cc(C(C)(C)C)c4ccccc4c3)c3cc([Si](C)(C)C)oc32)c1C |
| InChI | InChI=1S/C28H31NOSSi/c1-16-17(2)31-27-24(16)29-25(21-15-23(30-26(21)27)32(6,7)8)19-13-18-11-9-10-12-20(18)22(14-19)28(3,4)5/h9-15H,1-8H3 |
| InChIKey | WFIAKBTVGMDZPT-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.72 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|