C31H29N3 — CID 176812271
8-(2,2-dimethylpropyl)-4-[4-(2-isocyanopropan-2-yl)naphthalen-2-yl]benzo[h]quinazoline (PubChem CID 176812271) has the molecular formula C31H29N3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 8-(2,2-dimethylpropyl)-4-[4-(2-isocyanopropan-2-yl)naphthalen-2-yl]benzo[h]quinazoline.
| Compound Name | 8-(2,2-dimethylpropyl)-4-[4-(2-isocyanopropan-2-yl)naphthalen-2-yl]benzo[h]quinazoline |
|---|---|
| PubChem CID | 176812271 |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 8-(2,2-dimethylpropyl)-4-[4-(2-isocyanopropan-2-yl)naphthalen-2-yl]benzo[h]quinazoline |
| SMILES | [C-]#[N+]C(C)(C)c1cc(-c2ncnc3c2ccc2cc(CC(C)(C)C)ccc23)cc2ccccc12 |
| InChI | InChI=1S/C31H29N3/c1-30(2,3)18-20-11-13-25-22(15-20)12-14-26-28(33-19-34-29(25)26)23-16-21-9-7-8-10-24(21)27(17-23)31(4,5)32-6/h7-17,19H,18H2,1-5H3 |
| InChIKey | RCEQECCRLFYCNE-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|