C31H27N3O — CID 176812249
17-(2,2-dimethylpropyl)-10-(2-isocyanopropan-2-yl)-12-oxa-22,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene (PubChem CID 176812249) has the molecular formula C31H27N3O and a molecular weight of 457.58 g/mol. Its IUPAC name is 17-(2,2-dimethylpropyl)-10-(2-isocyanopropan-2-yl)-12-oxa-22,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 17-(2,2-dimethylpropyl)-10-(2-isocyanopropan-2-yl)-12-oxa-22,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 176812249 |
| Molecular Formula | C31H27N3O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 17-(2,2-dimethylpropyl)-10-(2-isocyanopropan-2-yl)-12-oxa-22,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
| SMILES | [C-]#[N+]C(C)(C)c1c2c(cc3ccccc13)-c1ncnc3c1c(cc1cc(CC(C)(C)C)ccc13)O2 |
| InChI | InChI=1S/C31H27N3O/c1-30(2,3)16-18-11-12-22-20(13-18)15-24-25-27(22)33-17-34-28(25)23-14-19-9-7-8-10-21(19)26(29(23)35-24)31(4,5)32-6/h7-15,17H,16H2,1-5H3 |
| InChIKey | CGPVBJLPYRROIQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|