C25H23N3 — CID 176812267
7-(2,2-dimethylpropyl)-4-[4-(isocyanomethyl)naphthalen-2-yl]quinazoline (PubChem CID 176812267) has the molecular formula C25H23N3 and a molecular weight of 365.48 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-4-[4-(isocyanomethyl)naphthalen-2-yl]quinazoline.
| Compound Name | 7-(2,2-dimethylpropyl)-4-[4-(isocyanomethyl)naphthalen-2-yl]quinazoline |
|---|---|
| PubChem CID | 176812267 |
| Molecular Formula | C25H23N3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-4-[4-(isocyanomethyl)naphthalen-2-yl]quinazoline |
| SMILES | [C-]#[N+]Cc1cc(-c2ncnc3cc(CC(C)(C)C)ccc23)cc2ccccc12 |
| InChI | InChI=1S/C25H23N3/c1-25(2,3)14-17-9-10-22-23(11-17)27-16-28-24(22)19-12-18-7-5-6-8-21(18)20(13-19)15-26-4/h5-13,16H,14-15H2,1-3H3 |
| InChIKey | XRJVXGYUZZHJSX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|