C39H43N3 — CID 177119925
13,14,18-tris(2,2-dimethylpropyl)-23,25,27-triazaheptacyclo[13.10.2.02,11.04,9.012,27.016,21.022,26]heptacosa-1(25),2,4,6,8,10,12,14,16(21),17,19,22(26),23-tridecaene (PubChem CID 177119925) has the molecular formula C39H43N3 and a molecular weight of 553.79 g/mol. Its IUPAC name is 13,14,18-tris(2,2-dimethylpropyl)-23,25,27-triazaheptacyclo[13.10.2.02,11.04,9.012,27.016,21.022,26]heptacosa-1(25),2,4,6,8,10,12,14,16(21),17,19,22(26),23-tridecaene.
| Compound Name | 13,14,18-tris(2,2-dimethylpropyl)-23,25,27-triazaheptacyclo[13.10.2.02,11.04,9.012,27.016,21.022,26]heptacosa-1(25),2,4,6,8,10,12,14,16(21),17,19,22(26),23-tridecaene |
|---|---|
| PubChem CID | 177119925 |
| Molecular Formula | C39H43N3 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | 13,14,18-tris(2,2-dimethylpropyl)-23,25,27-triazaheptacyclo[13.10.2.02,11.04,9.012,27.016,21.022,26]heptacosa-1(25),2,4,6,8,10,12,14,16(21),17,19,22(26),23-tridecaene |
| SMILES | CC(C)(C)Cc1ccc2c(c1)c1c(CC(C)(C)C)c(CC(C)(C)C)c3c4cc5ccccc5cc4c4ncnc2c4n13 |
| InChI | InChI=1S/C39H43N3/c1-37(2,3)19-23-14-15-26-28(16-23)34-30(20-38(4,5)6)31(21-39(7,8)9)35-29-18-25-13-11-10-12-24(25)17-27(29)33-36(42(34)35)32(26)40-22-41-33/h10-18,22H,19-21H2,1-9H3 |
| InChIKey | IKQCIGCHGHNTAE-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|