C17H11F8N — CID 165383782
3-(3,5-dimethylphenyl)-5,5,6,6,7,7,8,8-octafluoroisoquinoline (PubChem CID 165383782) has the molecular formula C17H11F8N and a molecular weight of 381.27 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-5,5,6,6,7,7,8,8-octafluoroisoquinoline.
| Compound Name | 3-(3,5-dimethylphenyl)-5,5,6,6,7,7,8,8-octafluoroisoquinoline |
|---|---|
| PubChem CID | 165383782 |
| Molecular Formula | C17H11F8N |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-5,5,6,6,7,7,8,8-octafluoroisoquinoline |
| SMILES | Cc1cc(C)cc(-c2cc3c(cn2)C(F)(F)C(F)(F)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C17H11F8N/c1-8-3-9(2)5-10(4-8)13-6-11-12(7-26-13)15(20,21)17(24,25)16(22,23)14(11,18)19/h3-7H,1-2H3 |
| InChIKey | CCTQHMOHGLHWPB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|