C21H21N2+ — CID 158582788
9-(6-deuterio-1-methylpyridin-1-ium-2-yl)-1,2,6-trimethylcarbazole (PubChem CID 158582788) has the molecular formula C21H21N2+ and a molecular weight of 302.42 g/mol. Its IUPAC name is 9-(6-deuterio-1-methylpyridin-1-ium-2-yl)-1,2,6-trimethylcarbazole.
| Compound Name | 9-(6-deuterio-1-methylpyridin-1-ium-2-yl)-1,2,6-trimethylcarbazole |
|---|---|
| PubChem CID | 158582788 |
| Molecular Formula | C21H21N2+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 9-(6-deuterio-1-methylpyridin-1-ium-2-yl)-1,2,6-trimethylcarbazole |
| SMILES | [2H]c1cccc(-n2c3ccc(C)cc3c3ccc(C)c(C)c32)[n+]1C |
| InChI | InChI=1S/C21H21N2/c1-14-8-11-19-18(13-14)17-10-9-15(2)16(3)21(17)23(19)20-7-5-6-12-22(20)4/h5-13H,1-4H3/q+1/i12D |
| InChIKey | VVVAKWVJNOWYDV-UQBWLURTSA-N |
| XLogP | 4.53 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|