C26H26N3Si+ — CID 166030020
trimethyl-(10,11,14-trimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-20-yl)silane (PubChem CID 166030020) has the molecular formula C26H26N3Si+ and a molecular weight of 408.60 g/mol. Its IUPAC name is trimethyl-(10,11,14-trimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-20-yl)silane.
| Compound Name | trimethyl-(10,11,14-trimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-20-yl)silane |
|---|---|
| PubChem CID | 166030020 |
| Molecular Formula | C26H26N3Si+ |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | trimethyl-(10,11,14-trimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-20-yl)silane |
| SMILES | Cc1cc2c3cccnc3n3c4c([Si](C)(C)C)ccc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C26H26N3Si/c1-15-14-19-18-8-7-12-27-26(18)29-23(19)21(16(15)2)25-22-17(11-13-28(25)3)9-10-20(24(22)29)30(4,5)6/h7-14H,1-6H3/q+1 |
| InChIKey | UNSQODPDLSFQBL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|