C32H31N2Si+ — CID 169015559
trimethyl-(14,17,22,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaen-9-yl)silane (PubChem CID 169015559) has the molecular formula C32H31N2Si+ and a molecular weight of 471.70 g/mol. Its IUPAC name is trimethyl-(14,17,22,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaen-9-yl)silane.
| Compound Name | trimethyl-(14,17,22,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaen-9-yl)silane |
|---|---|
| PubChem CID | 169015559 |
| Molecular Formula | C32H31N2Si+ |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | trimethyl-(14,17,22,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaen-9-yl)silane |
| SMILES | Cc1cccc2c(C)c3c(c(C)c12)n1c2ccccc2c2c([Si](C)(C)C)cc4cc[n+](C)c3c4c21 |
| InChI | InChI=1S/C32H31N2Si/c1-18-11-10-13-22-19(2)27-30(20(3)26(18)22)34-24-14-9-8-12-23(24)29-25(35(5,6)7)17-21-15-16-33(4)31(27)28(21)32(29)34/h8-17H,1-7H3/q+1 |
| InChIKey | LMGDTUQUWLFBOA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|