C27H25N2+ — CID 170231151
3,5,6,9,14,17-hexamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene (PubChem CID 170231151) has the molecular formula C27H25N2+ and a molecular weight of 377.51 g/mol. Its IUPAC name is 3,5,6,9,14,17-hexamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene.
| Compound Name | 3,5,6,9,14,17-hexamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene |
|---|---|
| PubChem CID | 170231151 |
| Molecular Formula | C27H25N2+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3,5,6,9,14,17-hexamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene |
| SMILES | Cc1cc(C)c2c(c1C)c1c3c(cc[n+]1C)cc(C)c1c4c(C)cccc4n2c13 |
| InChI | InChI=1S/C27H25N2/c1-14-8-7-9-20-21(14)22-16(3)13-19-10-11-28(6)26-23-18(5)15(2)12-17(4)25(23)29(20)27(22)24(19)26/h7-13H,1-6H3/q+1 |
| InChIKey | YUMJGYBHFLYKEE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|