C27H22N3+ — CID 169015294
14-isocyano-3,5,6,9,19-pentamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12,14,16(21),17,19,22-undecaene (PubChem CID 169015294) has the molecular formula C27H22N3+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 14-isocyano-3,5,6,9,19-pentamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12,14,16(21),17,19,22-undecaene.
| Compound Name | 14-isocyano-3,5,6,9,19-pentamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12,14,16(21),17,19,22-undecaene |
|---|---|
| PubChem CID | 169015294 |
| Molecular Formula | C27H22N3+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 14-isocyano-3,5,6,9,19-pentamethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12,14,16(21),17,19,22-undecaene |
| SMILES | [C-]#[N+]c1cc2cc[n+](C)c3c4c(C)c(C)cc(C)c4n4c5cc(C)ccc5c1c4c23 |
| InChI | InChI=1S/C27H22N3/c1-14-7-8-19-21(11-14)30-25-16(3)12-15(2)17(4)22(25)26-23-18(9-10-29(26)6)13-20(28-5)24(19)27(23)30/h7-13H,1-4,6H3/q+1 |
| InChIKey | WAHHKTYDUJLAFQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|