C30H22N3+ — CID 169015456
14,17,20,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-4-carbonitrile (PubChem CID 169015456) has the molecular formula C30H22N3+ and a molecular weight of 424.53 g/mol. Its IUPAC name is 14,17,20,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-4-carbonitrile.
| Compound Name | 14,17,20,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-4-carbonitrile |
|---|---|
| PubChem CID | 169015456 |
| Molecular Formula | C30H22N3+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 14,17,20,24-tetramethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-4-carbonitrile |
| SMILES | Cc1ccc2c(C)c3c(c(C)c2c1)c1c2c(ccc4c5ccc(C#N)cc5n3c42)cc[n+]1C |
| InChI | InChI=1S/C30H22N3/c1-16-5-8-21-18(3)28-26(17(2)24(21)13-16)30-27-20(11-12-32(30)4)7-10-23-22-9-6-19(15-31)14-25(22)33(28)29(23)27/h5-14H,1-4H3/q+1 |
| InChIKey | IONWCTNMWXZKEX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 32.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|