C29H29N2+ — CID 170231499
19-tert-butyl-3,5,6,9-tetramethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene (PubChem CID 170231499) has the molecular formula C29H29N2+ and a molecular weight of 405.57 g/mol. Its IUPAC name is 19-tert-butyl-3,5,6,9-tetramethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene.
| Compound Name | 19-tert-butyl-3,5,6,9-tetramethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene |
|---|---|
| PubChem CID | 170231499 |
| Molecular Formula | C29H29N2+ |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 19-tert-butyl-3,5,6,9-tetramethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene |
| SMILES | Cc1cc(C)c2c(c1C)c1c3c(ccc4c5ccc(C(C)(C)C)cc5n2c43)cc[n+]1C |
| InChI | InChI=1S/C29H29N2/c1-16-14-17(2)26-24(18(16)3)28-25-19(12-13-30(28)7)8-10-22-21-11-9-20(29(4,5)6)15-23(21)31(26)27(22)25/h8-15H,1-7H3/q+1 |
| InChIKey | JQKPKYUDUDGJLP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|