C33H28N3+ — CID 169015510
20-(2,2-dimethylpropyl)-14,17-dimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-3-carbonitrile (PubChem CID 169015510) has the molecular formula C33H28N3+ and a molecular weight of 466.61 g/mol. Its IUPAC name is 20-(2,2-dimethylpropyl)-14,17-dimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-3-carbonitrile.
| Compound Name | 20-(2,2-dimethylpropyl)-14,17-dimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-3-carbonitrile |
|---|---|
| PubChem CID | 169015510 |
| Molecular Formula | C33H28N3+ |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 20-(2,2-dimethylpropyl)-14,17-dimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene-3-carbonitrile |
| SMILES | Cc1c2cc(CC(C)(C)C)ccc2cc2c1c1c3c(ccc4c5cccc(C#N)c5n2c43)cc[n+]1C |
| InChI | InChI=1S/C33H28N3/c1-19-26-15-20(17-33(2,3)4)9-10-22(26)16-27-28(19)32-29-21(13-14-35(32)5)11-12-25-24-8-6-7-23(18-34)30(24)36(27)31(25)29/h6-16H,17H2,1-5H3/q+1 |
| InChIKey | CDBRLKSKQJACQM-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 32.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|