C33H31N2+ — CID 166030344
22-(2,2-dimethylpropyl)-11,12,15-trimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene (PubChem CID 166030344) has the molecular formula C33H31N2+ and a molecular weight of 455.63 g/mol. Its IUPAC name is 22-(2,2-dimethylpropyl)-11,12,15-trimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene.
| Compound Name | 22-(2,2-dimethylpropyl)-11,12,15-trimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene |
|---|---|
| PubChem CID | 166030344 |
| Molecular Formula | C33H31N2+ |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 22-(2,2-dimethylpropyl)-11,12,15-trimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene |
| SMILES | Cc1cc2c3ccccc3n3c4cc5cc(CC(C)(C)C)ccc5c5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C33H31N2/c1-19-15-26-24-9-7-8-10-27(24)35-28-17-22-16-21(18-33(3,4)5)11-12-23(22)25-13-14-34(6)32(30(25)28)29(20(19)2)31(26)35/h7-17H,18H2,1-6H3/q+1 |
| InChIKey | USOHIXQDZIJOSD-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|