C32H37GeN2+ — CID 166030473
[6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl]-trimethylgermane (PubChem CID 166030473) has the molecular formula C32H37GeN2+ and a molecular weight of 522.27 g/mol. Its IUPAC name is [6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl]-trimethylgermane.
| Compound Name | [6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl]-trimethylgermane |
|---|---|
| PubChem CID | 166030473 |
| Molecular Formula | C32H37GeN2+ |
| Molecular Weight | 522.27 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl]-trimethylgermane |
| SMILES | Cc1cc2c3c(CC(C)(C)C)cccc3n3c4cc([Ge](C)(C)C)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C32H37GeN2/c1-19-15-24-28-22(18-32(3,4)5)11-10-12-25(28)35-26-17-23(33(6,7)8)16-21-13-14-34(9)31(29(21)26)27(20(19)2)30(24)35/h10-17H,18H2,1-9H3/q+1 |
| InChIKey | OWKHVKDYCHYZBB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.27 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|