C28H28N3+ — CID 166030018
6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 166030018) has the molecular formula C28H28N3+ and a molecular weight of 406.55 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 166030018 |
| Molecular Formula | C28H28N3+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | Cc1cc2c3c(CC(C)(C)C)cccc3n3c4cccc5nc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C28H28N3/c1-16-13-19-24-18(14-28(3,4)5)9-7-11-21(24)31-22-12-8-10-20-25(22)27(30(6)15-29-20)23(17(16)2)26(19)31/h7-13,15H,14H2,1-6H3/q+1 |
| InChIKey | NJKNJZNIDFBRIW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|