C26H23FN3+ — CID 166030144
19-fluoro-10,11,14-trimethyl-6-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 166030144) has the molecular formula C26H23FN3+ and a molecular weight of 396.49 g/mol. Its IUPAC name is 19-fluoro-10,11,14-trimethyl-6-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 19-fluoro-10,11,14-trimethyl-6-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 166030144 |
| Molecular Formula | C26H23FN3+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 19-fluoro-10,11,14-trimethyl-6-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | Cc1cc2c3c(C(C)C)cccc3n3c4cc(F)cc5nc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C26H23FN3/c1-13(2)17-7-6-8-20-23(17)18-9-14(3)15(4)22-25(18)30(20)21-11-16(27)10-19-24(21)26(22)29(5)12-28-19/h6-13H,1-5H3/q+1 |
| InChIKey | ZVWTYQQQKOXULH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|