C28H30N3Si+ — CID 170684971
(11,14-dimethyl-3-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-19-yl)-trimethylsilane (PubChem CID 170684971) has the molecular formula C28H30N3Si+ and a molecular weight of 436.66 g/mol. Its IUPAC name is (11,14-dimethyl-3-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-19-yl)-trimethylsilane.
| Compound Name | (11,14-dimethyl-3-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-19-yl)-trimethylsilane |
|---|---|
| PubChem CID | 170684971 |
| Molecular Formula | C28H30N3Si+ |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (11,14-dimethyl-3-propan-2-yl-1,16-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaen-19-yl)-trimethylsilane |
| SMILES | Cc1ccc2c3cccc(C(C)C)c3n3c4cc([Si](C)(C)C)cc5nc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C28H30N3Si/c1-16(2)19-9-8-10-20-21-12-11-17(3)24-27(21)31(26(19)20)23-14-18(32(5,6)7)13-22-25(23)28(24)30(4)15-29-22/h8-16H,1-7H3/q+1 |
| InChIKey | XPXXQGVAAJJIFS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|