C24H21N2O+ — CID 170684387
11,14-dimethyl-19-propan-2-yl-18-oxa-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8(21),9,11,13,15,17(22),19-decaene (PubChem CID 170684387) has the molecular formula C24H21N2O+ and a molecular weight of 353.45 g/mol. Its IUPAC name is 11,14-dimethyl-19-propan-2-yl-18-oxa-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8(21),9,11,13,15,17(22),19-decaene.
| Compound Name | 11,14-dimethyl-19-propan-2-yl-18-oxa-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8(21),9,11,13,15,17(22),19-decaene |
|---|---|
| PubChem CID | 170684387 |
| Molecular Formula | C24H21N2O+ |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 11,14-dimethyl-19-propan-2-yl-18-oxa-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8(21),9,11,13,15,17(22),19-decaene |
| SMILES | Cc1ccc2c3ccccc3n3c4c(C(C)C)oc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C24H21N2O/c1-13(2)24-23-20-18(27-24)11-12-25(4)22(20)19-14(3)9-10-16-15-7-5-6-8-17(15)26(23)21(16)19/h5-13H,1-4H3/q+1 |
| InChIKey | ISHMSVVTWHWAME-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|