C28H18N3+ — CID 170685441
23-isocyano-12,15-dimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene (PubChem CID 170685441) has the molecular formula C28H18N3+ and a molecular weight of 396.47 g/mol. Its IUPAC name is 23-isocyano-12,15-dimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene.
| Compound Name | 23-isocyano-12,15-dimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene |
|---|---|
| PubChem CID | 170685441 |
| Molecular Formula | C28H18N3+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 23-isocyano-12,15-dimethyl-2-aza-15-azoniaheptacyclo[12.11.1.12,9.03,8.018,26.019,24.013,27]heptacosa-1(26),3,5,7,9(27),10,12,14,16,18,20,22,24-tridecaene |
| SMILES | [C-]#[N+]c1cccc2c1cc1c3c2cc[n+](C)c3c2c(C)ccc3c4ccccc4n1c32 |
| InChI | InChI=1S/C28H18N3/c1-16-11-12-20-18-7-4-5-10-23(18)31-24-15-21-17(8-6-9-22(21)29-2)19-13-14-30(3)28(26(19)24)25(16)27(20)31/h4-15H,1,3H3/q+1 |
| InChIKey | WUNPOIHMRDLLJC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 12.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|