C27H19N4+ — CID 170684614
3-isocyano-19-(1-isocyanoethyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 170684614) has the molecular formula C27H19N4+ and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-isocyano-19-(1-isocyanoethyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 3-isocyano-19-(1-isocyanoethyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 170684614 |
| Molecular Formula | C27H19N4+ |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-isocyano-19-(1-isocyanoethyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | [C-]#[N+]c1cccc2c3ccc(C)c4c3n(c3cc(C(C)[N+]#[C-])cc5cc[n+](C)c4c53)c12 |
| InChI | InChI=1S/C27H19N4/c1-15-9-10-20-19-7-6-8-21(29-4)25(19)31-22-14-18(16(2)28-3)13-17-11-12-30(5)27(24(17)22)23(15)26(20)31/h6-14,16H,1-2,5H3/q+1 |
| InChIKey | DMHOEYISIHBAIH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 17.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|